C19H16F2N6O — CID 142346140
7-[5-amino-2-(2,4-difluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one (PubChem CID 142346140) has the molecular formula C19H16F2N6O and a molecular weight of 382.37 g/mol. Its IUPAC name is 7-[5-amino-2-(2,4-difluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one.
| Compound Name | 7-[5-amino-2-(2,4-difluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 142346140 |
| Molecular Formula | C19H16F2N6O |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 7-[5-amino-2-(2,4-difluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one |
| SMILES | Cn1nc2c(-c3cc(N)ccc3Nc3ccc(F)cc3F)cn(C)c(=O)c2n1 |
| InChI | InChI=1S/C19H16F2N6O/c1-26-9-13(17-18(19(26)28)25-27(2)24-17)12-8-11(22)4-6-15(12)23-16-5-3-10(20)7-14(16)21/h3-9,23H,22H2,1-2H3 |
| InChIKey | ZBUQKPVTIXSYIE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|