About 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one
7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one (PubChem CID 142346447) has the molecular formula C18H19N5O3
and a molecular weight of 353.38 g/mol. Its IUPAC name is 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one.
Molecular Properties
| Compound Name | 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one |
| PubChem CID | 142346447 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one |
| SMILES | Cn1cc2c(=O)n(C)cc(-c3cc([N+](=O)[O-])ccc3NCC3CC3)c2n1 |
| InChI | InChI=1S/C18H19N5O3/c1-21-9-14(17-15(18(21)24)10-22(2)20-17)13-7-12(23(25)26)5-6-16(13)19-8-11-3-4-11/h5-7,9-11,19H,3-4,8H2,1-2H3 |
| InChIKey | BAIAEOVOLKJNJT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one (CID 142346447) is 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one is Cn1cc2c(=O)n(C)cc(-c3cc([N+](=O)[O-])ccc3NCC3CC3)c2n1.
What is the InChIKey of 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one?
The InChIKey is BAIAEOVOLKJNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O3/c1-21-9-14(17-15(18(21)24)10-22(2)20-17)13-7-12(23(25)26)5-6-16(13)19-8-11-3-4-11/h5-7,9-11,19H,3-4,8H2,1-2H3.
What are the key properties of 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one?
7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one has a molecular weight of 353.38 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(cyclopropylmethylamino)-5-nitrophenyl]-2,5-dimethylpyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 142346447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).