About CID 142346676
CID 142346676 (PubChem CID 142346676) has the molecular formula C28H30FN2O7SSi
and a molecular weight of 585.71 g/mol.
Molecular Properties
| Compound Name | CID 142346676 |
| PubChem CID | 142346676 |
| Molecular Formula | C28H30FN2O7SSi |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | — |
| SMILES | Cn1cc(-c2cc(CS(C)(=O)=O)ccc2C(=O)c2ccc(F)cc2)c([C@H](CC(=O)OC(C)(C)C)N[Si]=O)cc1=O |
| InChI | InChI=1S/C28H30FN2O7SSi/c1-28(2,3)38-26(33)14-24(30-40-37)22-13-25(32)31(4)15-23(22)21-12-17(16-39(5,35)36)6-11-20(21)27(34)18-7-9-19(29)10-8-18/h6-13,15,24,30H,14,16H2,1-5H3/t24-/m0/s1 |
| InChIKey | WVJOKUQMGQRUEN-DEOSSOPVSA-N |
| XLogP | 3.29 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142346676 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142346676?
The IUPAC name of CID 142346676 (CID 142346676) is not available.
What is the SMILES notation for CID 142346676?
The canonical SMILES for CID 142346676 is Cn1cc(-c2cc(CS(C)(=O)=O)ccc2C(=O)c2ccc(F)cc2)c([C@H](CC(=O)OC(C)(C)C)N[Si]=O)cc1=O.
What is the InChIKey of CID 142346676?
The InChIKey is WVJOKUQMGQRUEN-DEOSSOPVSA-N. The full InChI is InChI=1S/C28H30FN2O7SSi/c1-28(2,3)38-26(33)14-24(30-40-37)22-13-25(32)31(4)15-23(22)21-12-17(16-39(5,35)36)6-11-20(21)27(34)18-7-9-19(29)10-8-18/h6-13,15,24,30H,14,16H2,1-5H3/t24-/m0/s1.
What are the key properties of CID 142346676?
CID 142346676 has a molecular weight of 585.71 g/mol, XLogP of 3.29, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142346676 is sourced from PubChem (CID 142346676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).