C8H13O2P — CID 142346782
[(3E,5Z)-octa-3,5,7-trien-4-yl]phosphonous acid (PubChem CID 142346782) has the molecular formula C8H13O2P and a molecular weight of 172.16 g/mol. Its IUPAC name is [(3E,5Z)-octa-3,5,7-trien-4-yl]phosphonous acid.
| Compound Name | [(3E,5Z)-octa-3,5,7-trien-4-yl]phosphonous acid |
|---|---|
| PubChem CID | 142346782 |
| Molecular Formula | C8H13O2P |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | [(3E,5Z)-octa-3,5,7-trien-4-yl]phosphonous acid |
| SMILES | C=C/C=C\C(=C/CC)P(O)O |
| InChI | InChI=1S/C8H13O2P/c1-3-5-7-8(6-4-2)11(9)10/h3,5-7,9-10H,1,4H2,2H3/b7-5-,8-6+ |
| InChIKey | JZSMRYLRZUYCLY-CGXWXWIYSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|