About 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid
2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid (PubChem CID 14234703) has the molecular formula C14H17NO3S
and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid |
| PubChem CID | 14234703 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid |
| SMILES | Cc1cccc2c1OC(C(C)C)C(=S)N2CC(=O)O |
| InChI | InChI=1S/C14H17NO3S/c1-8(2)12-14(19)15(7-11(16)17)10-6-4-5-9(3)13(10)18-12/h4-6,8,12H,7H2,1-3H3,(H,16,17) |
| InChIKey | KBKCZSQBHAQKLY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid?
The IUPAC name of 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid (CID 14234703) is 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid.
What is the SMILES notation for 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid?
The canonical SMILES for 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid is Cc1cccc2c1OC(C(C)C)C(=S)N2CC(=O)O.
What is the InChIKey of 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid?
The InChIKey is KBKCZSQBHAQKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-8(2)12-14(19)15(7-11(16)17)10-6-4-5-9(3)13(10)18-12/h4-6,8,12H,7H2,1-3H3,(H,16,17).
What are the key properties of 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid?
2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid has a molecular weight of 279.36 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methyl-2-propan-2-yl-3-sulfanylidene-1,4-benzoxazin-4-yl)acetic acid is sourced from PubChem (CID 14234703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).