C66H66B3NO6 — CID 142347277
9-[2,5-diphenyl-3,4,6-tris[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole (PubChem CID 142347277) has the molecular formula C66H66B3NO6 and a molecular weight of 1001.69 g/mol. Its IUPAC name is 9-[2,5-diphenyl-3,4,6-tris[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole.
| Compound Name | 9-[2,5-diphenyl-3,4,6-tris[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 142347277 |
| Molecular Formula | C66H66B3NO6 |
| Molecular Weight | 1001.69 g/mol |
| Exact Mass | 1001.52 |
| IUPAC Name | 9-[2,5-diphenyl-3,4,6-tris[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]carbazole |
| SMILES | CC1(C)OB(c2ccc(-c3c(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)c(-c4ccccc4)c(-n4c5ccccc5c5ccccc54)c(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)c3-c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C66H66B3NO6/c1-61(2)62(3,4)72-67(71-61)48-37-31-45(32-38-48)55-56(43-23-15-13-16-24-43)59(47-35-41-50(42-36-47)69-75-65(9,10)66(11,12)76-69)60(70-53-29-21-19-27-51(53)52-28-20-22-30-54(52)70)58(44-25-17-14-18-26-44)57(55)46-33-39-49(40-34-46)68-73-63(5,6)64(7,8)74-68/h13-42H,1-12H3 |
| InChIKey | HVIYEAUUSBEJDF-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 60.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.69 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|