C19H21BFN3O2 — CID 142348071
1-[(2-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine (PubChem CID 142348071) has the molecular formula C19H21BFN3O2 and a molecular weight of 353.21 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 142348071 |
| Molecular Formula | C19H21BFN3O2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine |
| SMILES | CC1(C)OB(c2nn(Cc3ccccc3F)c3ncccc23)OC1(C)C |
| InChI | InChI=1S/C19H21BFN3O2/c1-18(2)19(3,4)26-20(25-18)16-14-9-7-11-22-17(14)24(23-16)12-13-8-5-6-10-15(13)21/h5-11H,12H2,1-4H3 |
| InChIKey | GBTWSPKLXCTUHR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|