C23H20N6O4 — CID 1423481
6-(2,5-dimethylphenyl)-2,4-dimethyl-7-(4-nitrophenyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 1423481) has the molecular formula C23H20N6O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)-2,4-dimethyl-7-(4-nitrophenyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2,5-dimethylphenyl)-2,4-dimethyl-7-(4-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 1423481 |
| Molecular Formula | C23H20N6O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 6-(2,5-dimethylphenyl)-2,4-dimethyl-7-(4-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1ccc(C)c(-n2c(-c3ccc([N+](=O)[O-])cc3)cn3c4c(=O)n(C)c(=O)n(C)c4nc23)c1 |
| InChI | InChI=1S/C23H20N6O4/c1-13-5-6-14(2)17(11-13)28-18(15-7-9-16(10-8-15)29(32)33)12-27-19-20(24-22(27)28)25(3)23(31)26(4)21(19)30/h5-12H,1-4H3 |
| InChIKey | GVGCGLLOZXIRKB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|