C31H37F2NO6 — CID 142348600
(2S,4R,6S,8S,9S,11S,12R,13S,19S)-8-[2-(4-aminophenoxy)acetyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 142348600) has the molecular formula C31H37F2NO6 and a molecular weight of 557.63 g/mol. Its IUPAC name is (2S,4R,6S,8S,9S,11S,12R,13S,19S)-8-[2-(4-aminophenoxy)acetyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (2S,4R,6S,8S,9S,11S,12R,13S,19S)-8-[2-(4-aminophenoxy)acetyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 142348600 |
| Molecular Formula | C31H37F2NO6 |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (2S,4R,6S,8S,9S,11S,12R,13S,19S)-8-[2-(4-aminophenoxy)acetyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCC[C@H]1O[C@@H]2C[C@H]3C4C[C@H](F)C5=CC(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@]2(C(=O)COc2ccc(N)cc2)O1 |
| InChI | InChI=1S/C31H37F2NO6/c1-4-5-27-39-26-14-20-21-13-23(32)22-12-18(35)10-11-28(22,2)30(21,33)24(36)15-29(20,3)31(26,40-27)25(37)16-38-19-8-6-17(34)7-9-19/h6-12,20-21,23-24,26-27,36H,4-5,13-16,34H2,1-3H3/t20-,21?,23-,24-,26+,27-,28-,29-,30-,31+/m0/s1 |
| InChIKey | GRHPPGYNDIZMRF-SCCBXNECSA-N |
| XLogP | 4.43 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|