C26H28F6O2 — CID 142348851
1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylcycloheptyl]propan-1-one (PubChem CID 142348851) has the molecular formula C26H28F6O2 and a molecular weight of 486.50 g/mol. Its IUPAC name is 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylcycloheptyl]propan-1-one.
| Compound Name | 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylcycloheptyl]propan-1-one |
|---|---|
| PubChem CID | 142348851 |
| Molecular Formula | C26H28F6O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylcycloheptyl]propan-1-one |
| SMILES | CCC(=O)C1CCC[C@@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C26H28F6O2/c1-3-22(33)18-8-7-11-21(23(2,16-18)19-9-5-4-6-10-19)17-12-14-20(15-13-17)24(34,25(27,28)29)26(30,31)32/h4-6,9-10,12-15,18,21,34H,3,7-8,11,16H2,1-2H3/t18?,21-,23+/m0/s1 |
| InChIKey | UPOSPYOCNYAADR-DNPUCPKASA-N |
| XLogP | 7.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |