About (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile
(3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile (PubChem CID 142349234) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile |
| PubChem CID | 142349234 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C(=C)C#N)N1CCNCC1 |
| InChI | InChI=1S/C11H15N3/c1-3-4-11(10(2)9-12)14-7-5-13-6-8-14/h3-4,13H,1-2,5-8H2/b11-4+ |
| InChIKey | ZKRBLLLPUJUDSL-NYYWCZLTSA-N |
| XLogP | 1.04 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile?
The IUPAC name of (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile (CID 142349234) is (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile.
What is the SMILES notation for (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile?
The canonical SMILES for (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile is C=C/C=C(\C(=C)C#N)N1CCNCC1.
What is the InChIKey of (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile?
The InChIKey is ZKRBLLLPUJUDSL-NYYWCZLTSA-N. The full InChI is InChI=1S/C11H15N3/c1-3-4-11(10(2)9-12)14-7-5-13-6-8-14/h3-4,13H,1-2,5-8H2/b11-4+.
What are the key properties of (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile?
(3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile has a molecular weight of 189.26 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-methylidene-3-piperazin-1-ylhexa-3,5-dienenitrile is sourced from PubChem (CID 142349234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).