C30H38ClN5O2 — CID 142349515
[4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)pyrrol-2-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 142349515) has the molecular formula C30H38ClN5O2 and a molecular weight of 536.12 g/mol. Its IUPAC name is [4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)pyrrol-2-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)pyrrol-2-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 142349515 |
| Molecular Formula | C30H38ClN5O2 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | [4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)pyrrol-2-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | COCCCn1cc(CN2CCN(c3ccccc3Cl)CC2)cc1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H38ClN5O2/c1-38-21-7-12-36-24-25(23-32-13-15-34(16-14-32)28-11-6-5-10-27(28)31)22-29(36)30(37)35-19-17-33(18-20-35)26-8-3-2-4-9-26/h2-6,8-11,22,24H,7,12-21,23H2,1H3 |
| InChIKey | RLQDZLCXQQHGEF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|