C18H28FN3O2 — CID 142349654
tert-butyl N-[1-[(2E,4Z)-3-cyano-5-fluorohepta-2,4-dien-4-yl]piperidin-4-yl]carbamate (PubChem CID 142349654) has the molecular formula C18H28FN3O2 and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl N-[1-[(2E,4Z)-3-cyano-5-fluorohepta-2,4-dien-4-yl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2E,4Z)-3-cyano-5-fluorohepta-2,4-dien-4-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142349654 |
| Molecular Formula | C18H28FN3O2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | tert-butyl N-[1-[(2E,4Z)-3-cyano-5-fluorohepta-2,4-dien-4-yl]piperidin-4-yl]carbamate |
| SMILES | C/C=C(C#N)\C(=C(\F)CC)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H28FN3O2/c1-6-13(12-20)16(15(19)7-2)22-10-8-14(9-11-22)21-17(23)24-18(3,4)5/h6,14H,7-11H2,1-5H3,(H,21,23)/b13-6-,16-15- |
| InChIKey | WYLJREMPJQFJJF-XTTIQGLUSA-N |
| XLogP | 4.04 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|