C26H41N3 — CID 142349780
(3Z)-3-methyl-2-methylidenehexa-3,5-dienenitrile;3-methylpentan-1-amine;N,2,4-trimethyl-5-prop-1-en-2-ylaniline (PubChem CID 142349780) has the molecular formula C26H41N3 and a molecular weight of 395.64 g/mol. Its IUPAC name is (3Z)-3-methyl-2-methylidenehexa-3,5-dienenitrile;3-methylpentan-1-amine;N,2,4-trimethyl-5-prop-1-en-2-ylaniline.
| Compound Name | (3Z)-3-methyl-2-methylidenehexa-3,5-dienenitrile;3-methylpentan-1-amine;N,2,4-trimethyl-5-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 142349780 |
| Molecular Formula | C26H41N3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | (3Z)-3-methyl-2-methylidenehexa-3,5-dienenitrile;3-methylpentan-1-amine;N,2,4-trimethyl-5-prop-1-en-2-ylaniline |
| SMILES | C=C(C)c1cc(NC)c(C)cc1C.C=C/C=C(/C)C(=C)C#N.CCC(C)CCN |
| InChI | InChI=1S/C12H17N.C8H9N.C6H15N/c1-8(2)11-7-12(13-5)10(4)6-9(11)3;1-4-5-7(2)8(3)6-9;1-3-6(2)4-5-7/h6-7,13H,1H2,2-5H3;4-5H,1,3H2,2H3;6H,3-5,7H2,1-2H3/b;7-5-; |
| InChIKey | WHXUAHMOIDEIKT-IQGCDTTGSA-N |
| XLogP | 6.96 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|