About (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile
(2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile (PubChem CID 142349875) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile |
| PubChem CID | 142349875 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C(\C=C)N1CCC(N)CC1 |
| InChI | InChI=1S/C12H17N3/c1-3-10(9-13)12(4-2)15-7-5-11(14)6-8-15/h3-4,11H,1-2,5-8,14H2/b12-10- |
| InChIKey | OCATUZPIOJJWRP-BENRWUELSA-N |
| XLogP | 1.56 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile?
The IUPAC name of (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile (CID 142349875) is (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile.
What is the SMILES notation for (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile?
The canonical SMILES for (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile is C=C/C(C#N)=C(\C=C)N1CCC(N)CC1.
What is the InChIKey of (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile?
The InChIKey is OCATUZPIOJJWRP-BENRWUELSA-N. The full InChI is InChI=1S/C12H17N3/c1-3-10(9-13)12(4-2)15-7-5-11(14)6-8-15/h3-4,11H,1-2,5-8,14H2/b12-10-.
What are the key properties of (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile?
(2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile has a molecular weight of 203.29 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-(4-aminopiperidin-1-yl)-2-ethenylpenta-2,4-dienenitrile is sourced from PubChem (CID 142349875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).