2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride

C9H6ClF4NO — CID 14235017

IUPAC2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride
SMILESCN(C)c1c(F)c(F)c(F)c(F)c1C(=O)Cl
InChIInChI=1S/C9H6ClF4NO/c1-15(2)8-3(9(10)16)4(11)5(12)6(13)7(8)14/h1-2H3
InChIKeyIWVZYQDULBTRBE-UHFFFAOYSA-N
MW255.60 g/mol
LogP2.69
Rot. Bonds2

About 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride

2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride (PubChem CID 14235017) has the molecular formula C9H6ClF4NO and a molecular weight of 255.60 g/mol. Its IUPAC name is 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride.

Molecular Properties

Compound Name2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride
PubChem CID14235017
Molecular FormulaC9H6ClF4NO
Molecular Weight255.60 g/mol
Exact Mass255.01
IUPAC Name2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride
SMILESCN(C)c1c(F)c(F)c(F)c(F)c1C(=O)Cl
InChIInChI=1S/C9H6ClF4NO/c1-15(2)8-3(9(10)16)4(11)5(12)6(13)7(8)14/h1-2H3
InChIKeyIWVZYQDULBTRBE-UHFFFAOYSA-N
XLogP2.69
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.60
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride?
The IUPAC name of 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride (CID 14235017) is 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride.
What is the SMILES notation for 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride?
The canonical SMILES for 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride is CN(C)c1c(F)c(F)c(F)c(F)c1C(=O)Cl.
What is the InChIKey of 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride?
The InChIKey is IWVZYQDULBTRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF4NO/c1-15(2)8-3(9(10)16)4(11)5(12)6(13)7(8)14/h1-2H3.
What are the key properties of 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride?
2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride has a molecular weight of 255.60 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-3,4,5,6-tetrafluorobenzoyl chloride is sourced from PubChem (CID 14235017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).