C20H22O6 — CID 14235025
5-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-5-phenylpentanoic acid (PubChem CID 14235025) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 5-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-5-phenylpentanoic acid.
| Compound Name | 5-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 14235025 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-5-phenylpentanoic acid |
| SMILES | COC1=C(OC)C(=O)C(C(CCCC(=O)O)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C20H22O6/c1-12-16(18(24)20(26-3)19(25-2)17(12)23)14(10-7-11-15(21)22)13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-11H2,1-3H3,(H,21,22) |
| InChIKey | KSKFDASBPHYPAW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|