C19H25FN4O3S2 — CID 142350455
ethyl 6-[[5-fluoro-2-(2-oxoethylsulfanylmethyl)piperidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 142350455) has the molecular formula C19H25FN4O3S2 and a molecular weight of 440.57 g/mol. Its IUPAC name is ethyl 6-[[5-fluoro-2-(2-oxoethylsulfanylmethyl)piperidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[[5-fluoro-2-(2-oxoethylsulfanylmethyl)piperidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142350455 |
| Molecular Formula | C19H25FN4O3S2 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | ethyl 6-[[5-fluoro-2-(2-oxoethylsulfanylmethyl)piperidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CC(F)CCC2CSCC=O)NC(c2nccs2)=NC1 |
| InChI | InChI=1S/C19H25FN4O3S2/c1-2-27-19(26)15-9-22-17(18-21-5-7-29-18)23-16(15)11-24-10-13(20)3-4-14(24)12-28-8-6-25/h5-7,13-14H,2-4,8-12H2,1H3,(H,22,23) |
| InChIKey | GFJAWBNMAZVWSV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|