C18H21FN4O3S — CID 142350537
ethyl 6-[[3-fluoro-4-[(E)-3-oxoprop-1-enyl]pyrrolidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 142350537) has the molecular formula C18H21FN4O3S and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 6-[[3-fluoro-4-[(E)-3-oxoprop-1-enyl]pyrrolidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[[3-fluoro-4-[(E)-3-oxoprop-1-enyl]pyrrolidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142350537 |
| Molecular Formula | C18H21FN4O3S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | ethyl 6-[[3-fluoro-4-[(E)-3-oxoprop-1-enyl]pyrrolidin-1-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CC(F)C(/C=C/C=O)C2)NC(c2nccs2)=NC1 |
| InChI | InChI=1S/C18H21FN4O3S/c1-2-26-18(25)13-8-21-16(17-20-5-7-27-17)22-15(13)11-23-9-12(4-3-6-24)14(19)10-23/h3-7,12,14H,2,8-11H2,1H3,(H,21,22)/b4-3+ |
| InChIKey | QPDGKWRWSBMMCU-ONEGZZNKSA-N |
| XLogP | 1.34 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|