C29H31NO3S — CID 142351178
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-hexan-3-yloxyphenyl)-2H-thiochromen-7-amine (PubChem CID 142351178) has the molecular formula C29H31NO3S and a molecular weight of 473.64 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-hexan-3-yloxyphenyl)-2H-thiochromen-7-amine.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-hexan-3-yloxyphenyl)-2H-thiochromen-7-amine |
|---|---|
| PubChem CID | 142351178 |
| Molecular Formula | C29H31NO3S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-hexan-3-yloxyphenyl)-2H-thiochromen-7-amine |
| SMILES | CCCC(CC)Oc1ccc(C2=C(c3ccc4c(c3)OCCO4)CSc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C29H31NO3S/c1-3-5-22(4-2)33-23-10-6-19(7-11-23)29-24-12-9-21(30)17-28(24)34-18-25(29)20-8-13-26-27(16-20)32-15-14-31-26/h6-13,16-17,22H,3-5,14-15,18,30H2,1-2H3 |
| InChIKey | SNQHGQPCUZPIGL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|