C33H56B2N2O5 — CID 142351346
5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1-(oxan-2-yl)indazole;ethane;propane (PubChem CID 142351346) has the molecular formula C33H56B2N2O5 and a molecular weight of 582.44 g/mol. Its IUPAC name is 5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1-(oxan-2-yl)indazole;ethane;propane.
| Compound Name | 5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1-(oxan-2-yl)indazole;ethane;propane |
|---|---|
| PubChem CID | 142351346 |
| Molecular Formula | C33H56B2N2O5 |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 582.44 |
| IUPAC Name | 5-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1-(oxan-2-yl)indazole;ethane;propane |
| SMILES | CC.CC/C(B1OC(C)(C)C(C)(C)O1)=C(/B1OC(C)(C)C(C)(C)O1)c1ccc2c(cnn2C2CCCCO2)c1.CCC |
| InChI | InChI=1S/C28H42B2N2O5.C3H8.C2H6/c1-10-21(29-34-25(2,3)26(4,5)35-29)24(30-36-27(6,7)28(8,9)37-30)19-14-15-22-20(17-19)18-31-32(22)23-13-11-12-16-33-23;1-3-2;1-2/h14-15,17-18,23H,10-13,16H2,1-9H3;3H2,1-2H3;1-2H3/b24-21-;; |
| InChIKey | BICFTYBSWGBFCP-FTPDKCCJSA-N |
| XLogP | 8.60 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|