C26H32F3N5O3Si — CID 142352437
1-[(6R,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2,6-difluoro-4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-7-yl]-3-(4-fluorophenyl)urea (PubChem CID 142352437) has the molecular formula C26H32F3N5O3Si and a molecular weight of 547.65 g/mol. Its IUPAC name is 1-[(6R,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2,6-difluoro-4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-7-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(6R,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2,6-difluoro-4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-7-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 142352437 |
| Molecular Formula | C26H32F3N5O3Si |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-[(6R,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2,6-difluoro-4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-7-yl]-3-(4-fluorophenyl)urea |
| SMILES | COc1cc(F)c([C@@H]2Cn3c(CO[Si](C)(C)C(C)(C)C)nnc3[C@H]2NC(=O)Nc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C26H32F3N5O3Si/c1-26(2,3)38(5,6)37-14-21-32-33-24-23(31-25(35)30-16-9-7-15(27)8-10-16)18(13-34(21)24)22-19(28)11-17(36-4)12-20(22)29/h7-12,18,23H,13-14H2,1-6H3,(H2,30,31,35)/t18-,23-/m0/s1 |
| InChIKey | BHEFEVKRDNRGKS-MBSDFSHPSA-N |
| XLogP | 5.89 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|