C13H13F2NO4 — CID 142352449
methyl (3S,4R)-4-[2,6-difluoro-4-(trideuteriomethoxy)phenyl]-2-oxopyrrolidine-3-carboxylate (PubChem CID 142352449) has the molecular formula C13H13F2NO4 and a molecular weight of 288.26 g/mol. Its IUPAC name is methyl (3S,4R)-4-[2,6-difluoro-4-(trideuteriomethoxy)phenyl]-2-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-[2,6-difluoro-4-(trideuteriomethoxy)phenyl]-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 142352449 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl (3S,4R)-4-[2,6-difluoro-4-(trideuteriomethoxy)phenyl]-2-oxopyrrolidine-3-carboxylate |
| SMILES | [2H]C([2H])([2H])Oc1cc(F)c([C@@H]2CNC(=O)[C@H]2C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C13H13F2NO4/c1-19-6-3-8(14)10(9(15)4-6)7-5-16-12(17)11(7)13(18)20-2/h3-4,7,11H,5H2,1-2H3,(H,16,17)/t7-,11-/m0/s1/i1D3 |
| InChIKey | IYLMKQKDQMBTNR-BXGPCRMISA-N |
| XLogP | 0.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|