C45H35N3 — CID 142352589
N-[3-ethenyl-4,4-dimethyl-6-[3-(10-phenylanthracen-9-yl)phenyl]-1-pyridin-2-ylquinolin-2-yl]methanimine (PubChem CID 142352589) has the molecular formula C45H35N3 and a molecular weight of 617.80 g/mol. Its IUPAC name is N-[3-ethenyl-4,4-dimethyl-6-[3-(10-phenylanthracen-9-yl)phenyl]-1-pyridin-2-ylquinolin-2-yl]methanimine.
| Compound Name | N-[3-ethenyl-4,4-dimethyl-6-[3-(10-phenylanthracen-9-yl)phenyl]-1-pyridin-2-ylquinolin-2-yl]methanimine |
|---|---|
| PubChem CID | 142352589 |
| Molecular Formula | C45H35N3 |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | N-[3-ethenyl-4,4-dimethyl-6-[3-(10-phenylanthracen-9-yl)phenyl]-1-pyridin-2-ylquinolin-2-yl]methanimine |
| SMILES | C=CC1=C(N=C)N(c2ccccn2)c2ccc(-c3cccc(-c4c5ccccc5c(-c5ccccc5)c5ccccc45)c3)cc2C1(C)C |
| InChI | InChI=1S/C45H35N3/c1-5-38-44(46-4)48(41-24-13-14-27-47-41)40-26-25-32(29-39(40)45(38,2)3)31-18-15-19-33(28-31)43-36-22-11-9-20-34(36)42(30-16-7-6-8-17-30)35-21-10-12-23-37(35)43/h5-29H,1,4H2,2-3H3 |
| InChIKey | QVJKRWGHEDDRBM-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|