C14H18N2 — CID 142353032
4-cyclohexa-1,3-dien-1-yl-N'-methylcyclohexa-1,3-diene-1-carboximidamide (PubChem CID 142353032) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-N'-methylcyclohexa-1,3-diene-1-carboximidamide.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-N'-methylcyclohexa-1,3-diene-1-carboximidamide |
|---|---|
| PubChem CID | 142353032 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-N'-methylcyclohexa-1,3-diene-1-carboximidamide |
| SMILES | C/N=C(\N)C1=CC=C(C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C14H18N2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-3,5,7,9H,4,6,8,10H2,1H3,(H2,15,16) |
| InChIKey | ROOSXXKOLUIISA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|