C17H11BrO — CID 142353444
4-bromo-9-oxatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene (PubChem CID 142353444) has the molecular formula C17H11BrO and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-bromo-9-oxatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene.
| Compound Name | 4-bromo-9-oxatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene |
|---|---|
| PubChem CID | 142353444 |
| Molecular Formula | C17H11BrO |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 4-bromo-9-oxatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene |
| SMILES | BrC1=Cc2c(oc3cc4ccccc4cc23)C=CC1 |
| InChI | InChI=1S/C17H11BrO/c18-13-6-3-7-16-15(10-13)14-8-11-4-1-2-5-12(11)9-17(14)19-16/h1-5,7-10H,6H2 |
| InChIKey | IVJVMPALOPOCNH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |