About [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium
[(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium (PubChem CID 142353699) has the molecular formula C13H19N2O+
and a molecular weight of 219.31 g/mol. Its IUPAC name is [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium.
Molecular Properties
| Compound Name | [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium |
| PubChem CID | 142353699 |
| Molecular Formula | C13H19N2O+ |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium |
| SMILES | Cc1cc(C)cc(CO/C=[N+](C)/C=C\N)c1 |
| InChI | InChI=1S/C13H19N2O/c1-11-6-12(2)8-13(7-11)9-16-10-15(3)5-4-14/h4-8,10H,9,14H2,1-3H3/q+1/b5-4-,15-10+ |
| InChIKey | VOAVIRDWIDSMJI-ASYGCKNGSA-N |
| XLogP | 1.92 |
| TPSA | 38.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium?
The IUPAC name of [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium (CID 142353699) is [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium.
What is the SMILES notation for [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium?
The canonical SMILES for [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium is Cc1cc(C)cc(CO/C=[N+](C)/C=C\N)c1.
What is the InChIKey of [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium?
The InChIKey is VOAVIRDWIDSMJI-ASYGCKNGSA-N. The full InChI is InChI=1S/C13H19N2O/c1-11-6-12(2)8-13(7-11)9-16-10-15(3)5-4-14/h4-8,10H,9,14H2,1-3H3/q+1/b5-4-,15-10+.
What are the key properties of [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium?
[(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium has a molecular weight of 219.31 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-aminoethenyl]-[(3,5-dimethylphenyl)methoxymethylidene]-methylazanium is sourced from PubChem (CID 142353699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).