C24H31N7O5S — CID 142353929
methyl N-[(1Z,3Z)-3-methoxy-4-[3-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylamino]-5-phenyl-1,2,4-triazol-4-yl]buta-1,3-dienyl]methanimidate;molecular hydrogen (PubChem CID 142353929) has the molecular formula C24H31N7O5S and a molecular weight of 529.62 g/mol. Its IUPAC name is methyl N-[(1Z,3Z)-3-methoxy-4-[3-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylamino]-5-phenyl-1,2,4-triazol-4-yl]buta-1,3-dienyl]methanimidate;molecular hydrogen.
| Compound Name | methyl N-[(1Z,3Z)-3-methoxy-4-[3-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylamino]-5-phenyl-1,2,4-triazol-4-yl]buta-1,3-dienyl]methanimidate;molecular hydrogen |
|---|---|
| PubChem CID | 142353929 |
| Molecular Formula | C24H31N7O5S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | methyl N-[(1Z,3Z)-3-methoxy-4-[3-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylamino]-5-phenyl-1,2,4-triazol-4-yl]buta-1,3-dienyl]methanimidate;molecular hydrogen |
| SMILES | CO/C=N\C=C/C(=C/n1c(NS(=O)(=O)[C@@H](C)[C@H](OC)c2ncc(C)cn2)nnc1-c1ccccc1)OC.[H][H] |
| InChI | InChI=1S/C24H29N7O5S.H2/c1-17-13-26-22(27-14-17)21(36-5)18(2)37(32,33)30-24-29-28-23(19-9-7-6-8-10-19)31(24)15-20(35-4)11-12-25-16-34-3;/h6-16,18,21H,1-5H3,(H,29,30);1H/b12-11-,20-15-,25-16-;/t18-,21-;/m0./s1 |
| InChIKey | OUZKHOYAMNWNLS-IAERPLPUSA-N |
| XLogP | 3.44 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|