C24H35NO — CID 142354542
1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane (PubChem CID 142354542) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane |
|---|---|
| PubChem CID | 142354542 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane |
| SMILES | CC.O=C(CCC1=CC=CCC1)CCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29NO.C2H6/c24-22(15-11-19-7-3-1-4-8-19)16-12-20-9-13-21(14-10-20)23-17-5-2-6-18-23;1-2/h1,3,7,9-10,13-14H,2,4-6,8,11-12,15-18H2;1-2H3 |
| InChIKey | PQDAWRDMSWULMI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|