About 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane
1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane (PubChem CID 142354542) has the molecular formula C24H35NO
and a molecular weight of 353.55 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane |
| PubChem CID | 142354542 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane |
| SMILES | CC.O=C(CCC1=CC=CCC1)CCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29NO.C2H6/c24-22(15-11-19-7-3-1-4-8-19)16-12-20-9-13-21(14-10-20)23-17-5-2-6-18-23;1-2/h1,3,7,9-10,13-14H,2,4-6,8,11-12,15-18H2;1-2H3 |
| InChIKey | PQDAWRDMSWULMI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane (CID 142354542) is 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane is CC.O=C(CCC1=CC=CCC1)CCc1ccc(N2CCCCC2)cc1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane?
The InChIKey is PQDAWRDMSWULMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO.C2H6/c24-22(15-11-19-7-3-1-4-8-19)16-12-20-9-13-21(14-10-20)23-17-5-2-6-18-23;1-2/h1,3,7,9-10,13-14H,2,4-6,8,11-12,15-18H2;1-2H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane?
1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane has a molecular weight of 353.55 g/mol, XLogP of 6.26, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-5-(4-piperidin-1-ylphenyl)pentan-3-one;ethane is sourced from PubChem (CID 142354542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).