About (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine
(3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine (PubChem CID 142354934) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine.
Molecular Properties
| Compound Name | (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine |
| PubChem CID | 142354934 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine |
| SMILES | [H]/N=C1C(=C\C)/C(C2=CNCC2)=CN/1C1CCCC1 |
| InChI | InChI=1S/C15H21N3/c1-2-13-14(11-7-8-17-9-11)10-18(15(13)16)12-5-3-4-6-12/h2,9-10,12,16-17H,3-8H2,1H3/b13-2-,16-15- |
| InChIKey | YSPMSKOCGQRXCM-IBXHHNNMSA-N |
| XLogP | 2.93 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine?
The IUPAC name of (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine (CID 142354934) is (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine.
What is the SMILES notation for (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine?
The canonical SMILES for (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine is [H]/N=C1C(=C\C)/C(C2=CNCC2)=CN/1C1CCCC1.
What is the InChIKey of (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine?
The InChIKey is YSPMSKOCGQRXCM-IBXHHNNMSA-N. The full InChI is InChI=1S/C15H21N3/c1-2-13-14(11-7-8-17-9-11)10-18(15(13)16)12-5-3-4-6-12/h2,9-10,12,16-17H,3-8H2,1H3/b13-2-,16-15-.
What are the key properties of (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine?
(3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine has a molecular weight of 243.35 g/mol, XLogP of 2.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-cyclopentyl-4-(2,3-dihydro-1H-pyrrol-4-yl)-3-ethylidenepyrrol-2-imine is sourced from PubChem (CID 142354934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).