C22H26N2 — CID 142355452
ethane;8-phenyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,5,9,12-hexaene (PubChem CID 142355452) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is ethane;8-phenyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,5,9,12-hexaene.
| Compound Name | ethane;8-phenyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,5,9,12-hexaene |
|---|---|
| PubChem CID | 142355452 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | ethane;8-phenyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),3,5,9,12-hexaene |
| SMILES | C1=CCC=c2c(c3cnccc3n2-c2ccccc2)=C1.CC.CC |
| InChI | InChI=1S/C18H14N2.2C2H6/c1-3-7-14(8-4-1)20-17-10-6-2-5-9-15(17)16-13-19-12-11-18(16)20;2*1-2/h1-5,7-13H,6H2;2*1-2H3 |
| InChIKey | WMOAHVLIALTOQM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |