C51H42N2 — CID 142356540
N-[(1Z)-3-methyl-2-[[2-(2-methylphenyl)-3-(9-phenylcarbazol-3-yl)phenyl]methyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine (PubChem CID 142356540) has the molecular formula C51H42N2 and a molecular weight of 682.91 g/mol. Its IUPAC name is N-[(1Z)-3-methyl-2-[[2-(2-methylphenyl)-3-(9-phenylcarbazol-3-yl)phenyl]methyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine.
| Compound Name | N-[(1Z)-3-methyl-2-[[2-(2-methylphenyl)-3-(9-phenylcarbazol-3-yl)phenyl]methyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 142356540 |
| Molecular Formula | C51H42N2 |
| Molecular Weight | 682.91 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | N-[(1Z)-3-methyl-2-[[2-(2-methylphenyl)-3-(9-phenylcarbazol-3-yl)phenyl]methyl]-1-phenylbuta-1,3-dienyl]-1-phenylethanimine |
| SMILES | C=C(C)/C(Cc1cccc(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)c1-c1ccccc1C)=C(\N=C(/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H42N2/c1-35(2)46(51(39-22-10-6-11-23-39)52-37(4)38-20-8-5-9-21-38)34-41-24-18-29-44(50(41)43-27-15-14-19-36(43)3)40-31-32-49-47(33-40)45-28-16-17-30-48(45)53(49)42-25-12-7-13-26-42/h5-33H,1,34H2,2-4H3/b51-46-,52-37+ |
| InChIKey | PFYILMCBSGMPRB-FUIHUQAKSA-N |
| XLogP | 13.47 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.91 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|