About 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol
3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol (PubChem CID 142358246) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol.
Molecular Properties
| Compound Name | 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol |
| PubChem CID | 142358246 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol |
| SMILES | C=C(C)C=C(C(=C)O)C(=C)O |
| InChI | InChI=1S/C9H12O2/c1-6(2)5-9(7(3)10)8(4)11/h5,10-11H,1,3-4H2,2H3 |
| InChIKey | VRJMNWJCFKDZEC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol?
The IUPAC name of 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol (CID 142358246) is 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol.
What is the SMILES notation for 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol?
The canonical SMILES for 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol is C=C(C)C=C(C(=C)O)C(=C)O.
What is the InChIKey of 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol?
The InChIKey is VRJMNWJCFKDZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-6(2)5-9(7(3)10)8(4)11/h5,10-11H,1,3-4H2,2H3.
What are the key properties of 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol?
3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol has a molecular weight of 152.19 g/mol, XLogP of 2.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylprop-2-enylidene)penta-1,4-diene-2,4-diol is sourced from PubChem (CID 142358246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).