C16H31N3 — CID 142358552
N-[1-(azetidin-3-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-3-methylbutan-2-imine;ethane (PubChem CID 142358552) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-[1-(azetidin-3-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-3-methylbutan-2-imine;ethane.
| Compound Name | N-[1-(azetidin-3-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-3-methylbutan-2-imine;ethane |
|---|---|
| PubChem CID | 142358552 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N-[1-(azetidin-3-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-3-methylbutan-2-imine;ethane |
| SMILES | CC.CC1=C(/N=C(\C)C(C)C)CCN(C2CNC2)C1 |
| InChI | InChI=1S/C14H25N3.C2H6/c1-10(2)12(4)16-14-5-6-17(9-11(14)3)13-7-15-8-13;1-2/h10,13,15H,5-9H2,1-4H3;1-2H3/b16-12+; |
| InChIKey | DMDGFLIOGGPGLW-CLNHMMGSSA-N |
| XLogP | 3.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|