C23H32N6O2 — CID 142358728
[2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl propanimidate;3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 142358728) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is [2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl propanimidate;3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | [2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl propanimidate;3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 142358728 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl propanimidate;3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | [H]/N=C(\CC)OCc1c(C)cccc1N(N)C(=O)N(C)N.[H]/N=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C13H21N5O2.C10H11N/c1-4-12(14)20-8-10-9(2)6-5-7-11(10)18(16)13(19)17(3)15;11-10-7-3-5-8-4-1-2-6-9(8)10/h5-7,14H,4,8,15-16H2,1-3H3;1-2,4,6,11H,3,5,7H2/b14-12+;11-10+ |
| InChIKey | FRICCESPUQEVBD-CZORTCMBSA-N |
| XLogP | 3.90 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|