C26H38N6O2 — CID 142358801
[2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate;N-amino-N-methylformamide (PubChem CID 142358801) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate;N-amino-N-methylformamide.
| Compound Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate;N-amino-N-methylformamide |
|---|---|
| PubChem CID | 142358801 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]propanehydrazonate;N-amino-N-methylformamide |
| SMILES | CCC(=NN=C(C)c1ccc2c(c1)CCCC2)OCc1c(C)cccc1N(C)N.CN(N)C=O |
| InChI | InChI=1S/C24H32N4O.C2H6N2O/c1-5-24(29-16-22-17(2)9-8-12-23(22)28(4)25)27-26-18(3)20-14-13-19-10-6-7-11-21(19)15-20;1-4(3)2-5/h8-9,12-15H,5-7,10-11,16,25H2,1-4H3;2H,3H2,1H3 |
| InChIKey | VVACWTTYEXNVIK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|