C15H16N4O3S — CID 142359054
N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]thiohydroxylamine (PubChem CID 142359054) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]thiohydroxylamine.
| Compound Name | N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 142359054 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]thiohydroxylamine |
| SMILES | COc1cccc(OC)c1-n1c(NS)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C15H16N4O3S/c1-9-7-8-12(22-9)14-16-17-15(18-23)19(14)13-10(20-2)5-4-6-11(13)21-3/h4-8,23H,1-3H3,(H,17,18) |
| InChIKey | SNTSGDVLVBHFKS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|