C18H10ClN7O2 — CID 1423592
10-(4-chlorophenyl)-4-(3-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 1423592) has the molecular formula C18H10ClN7O2 and a molecular weight of 391.78 g/mol. Its IUPAC name is 10-(4-chlorophenyl)-4-(3-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-(4-chlorophenyl)-4-(3-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 1423592 |
| Molecular Formula | C18H10ClN7O2 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 10-(4-chlorophenyl)-4-(3-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3c4cnn(-c5ccc(Cl)cc5)c4ncn3n2)c1 |
| InChI | InChI=1S/C18H10ClN7O2/c19-12-4-6-13(7-5-12)25-17-15(9-21-25)18-22-16(23-24(18)10-20-17)11-2-1-3-14(8-11)26(27)28/h1-10H |
| InChIKey | PSDBFPOEDLURBT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|