C7H10FN3S — CID 142359365
S-[2-(5-fluoropyrimidin-2-yl)propyl]thiohydroxylamine (PubChem CID 142359365) has the molecular formula C7H10FN3S and a molecular weight of 187.24 g/mol. Its IUPAC name is S-[2-(5-fluoropyrimidin-2-yl)propyl]thiohydroxylamine.
| Compound Name | S-[2-(5-fluoropyrimidin-2-yl)propyl]thiohydroxylamine |
|---|---|
| PubChem CID | 142359365 |
| Molecular Formula | C7H10FN3S |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | S-[2-(5-fluoropyrimidin-2-yl)propyl]thiohydroxylamine |
| SMILES | CC(CSN)c1ncc(F)cn1 |
| InChI | InChI=1S/C7H10FN3S/c1-5(4-12-9)7-10-2-6(8)3-11-7/h2-3,5H,4,9H2,1H3 |
| InChIKey | WBXDAJOQPXQQFV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|