C25H23FN6O2S2 — CID 142359547
2-[2-[[5-(4-cyclopropyl-1,3-thiazol-2-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile (PubChem CID 142359547) has the molecular formula C25H23FN6O2S2 and a molecular weight of 522.63 g/mol. Its IUPAC name is 2-[2-[[5-(4-cyclopropyl-1,3-thiazol-2-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile.
| Compound Name | 2-[2-[[5-(4-cyclopropyl-1,3-thiazol-2-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 142359547 |
| Molecular Formula | C25H23FN6O2S2 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 2-[2-[[5-(4-cyclopropyl-1,3-thiazol-2-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ccc(F)cc2C#N)nnc1-c1nc(C2CC2)cs1 |
| InChI | InChI=1S/C25H23FN6O2S2/c1-33-20-4-3-5-21(34-2)22(20)32-23(24-28-19(14-35-24)16-6-7-16)29-30-25(32)31-36-11-10-15-8-9-18(26)12-17(15)13-27/h3-5,8-9,12,14,16H,6-7,10-11H2,1-2H3,(H,30,31) |
| InChIKey | LDVSBIJYQWKIHH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|