C24H23FN6O2S2 — CID 142359772
2-[2-[[4-(2,6-dimethoxyphenyl)-5-(2-ethyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile (PubChem CID 142359772) has the molecular formula C24H23FN6O2S2 and a molecular weight of 510.62 g/mol. Its IUPAC name is 2-[2-[[4-(2,6-dimethoxyphenyl)-5-(2-ethyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile.
| Compound Name | 2-[2-[[4-(2,6-dimethoxyphenyl)-5-(2-ethyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 142359772 |
| Molecular Formula | C24H23FN6O2S2 |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 2-[2-[[4-(2,6-dimethoxyphenyl)-5-(2-ethyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-5-fluorobenzonitrile |
| SMILES | CCc1nc(-c2nnc(NSCCc3ccc(F)cc3C#N)n2-c2c(OC)cccc2OC)cs1 |
| InChI | InChI=1S/C24H23FN6O2S2/c1-4-21-27-18(14-34-21)23-28-29-24(31(23)22-19(32-2)6-5-7-20(22)33-3)30-35-11-10-15-8-9-17(25)12-16(15)13-26/h5-9,12,14H,4,10-11H2,1-3H3,(H,29,30) |
| InChIKey | CPUDGTMFPYLSAF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|