About ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione
ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione (PubChem CID 142360228) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione |
| PubChem CID | 142360228 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione |
| SMILES | CC.CC.CCC/C=C/CN1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O2.2C2H6/c1-2-3-4-5-7-12-8-6-9(13)11-10(12)14;2*1-2/h4-5H,2-3,6-8H2,1H3,(H,11,13,14);2*1-2H3/b5-4+;; |
| InChIKey | ZANYMSDQURBJRZ-SFKRKKMESA-N |
| XLogP | 3.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione?
The IUPAC name of ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione (CID 142360228) is ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione.
What is the SMILES notation for ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione?
The canonical SMILES for ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione is CC.CC.CCC/C=C/CN1CCC(=O)NC1=O.
What is the InChIKey of ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione?
The InChIKey is ZANYMSDQURBJRZ-SFKRKKMESA-N. The full InChI is InChI=1S/C10H16N2O2.2C2H6/c1-2-3-4-5-7-12-8-6-9(13)11-10(12)14;2*1-2/h4-5H,2-3,6-8H2,1H3,(H,11,13,14);2*1-2H3/b5-4+;;.
What are the key properties of ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione?
ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione has a molecular weight of 256.39 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(E)-hex-2-enyl]-1,3-diazinane-2,4-dione is sourced from PubChem (CID 142360228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).