C25H35FN4O3 — CID 142360422
4-cyclopropylidene-1-[(E)-5-[2-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pent-2-enyl]-5-methylimidazolidin-2-one (PubChem CID 142360422) has the molecular formula C25H35FN4O3 and a molecular weight of 458.58 g/mol. Its IUPAC name is 4-cyclopropylidene-1-[(E)-5-[2-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pent-2-enyl]-5-methylimidazolidin-2-one.
| Compound Name | 4-cyclopropylidene-1-[(E)-5-[2-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pent-2-enyl]-5-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 142360422 |
| Molecular Formula | C25H35FN4O3 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 4-cyclopropylidene-1-[(E)-5-[2-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pent-2-enyl]-5-methylimidazolidin-2-one |
| SMILES | CC1C(=C2CC2)NC(=O)N1C/C=C/CCNNC1(c2ccc(F)c(OCC(C)(C)O)c2)CC1 |
| InChI | InChI=1S/C25H35FN4O3/c1-17-22(18-7-8-18)28-23(31)30(17)14-6-4-5-13-27-29-25(11-12-25)19-9-10-20(26)21(15-19)33-16-24(2,3)32/h4,6,9-10,15,17,27,29,32H,5,7-8,11-14,16H2,1-3H3,(H,28,31)/b6-4+ |
| InChIKey | SQGDFKUCJXCSMH-GQCTYLIASA-N |
| XLogP | 3.47 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|