About 1-hept-6-enyl-1,3-diazinane-2,4-dione
1-hept-6-enyl-1,3-diazinane-2,4-dione (PubChem CID 142360742) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-hept-6-enyl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 1-hept-6-enyl-1,3-diazinane-2,4-dione |
| PubChem CID | 142360742 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-hept-6-enyl-1,3-diazinane-2,4-dione |
| SMILES | C=CCCCCCN1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H18N2O2/c1-2-3-4-5-6-8-13-9-7-10(14)12-11(13)15/h2H,1,3-9H2,(H,12,14,15) |
| InChIKey | CFECPPGQRASFGZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-6-enyl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-6-enyl-1,3-diazinane-2,4-dione?
The IUPAC name of 1-hept-6-enyl-1,3-diazinane-2,4-dione (CID 142360742) is 1-hept-6-enyl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 1-hept-6-enyl-1,3-diazinane-2,4-dione?
The canonical SMILES for 1-hept-6-enyl-1,3-diazinane-2,4-dione is C=CCCCCCN1CCC(=O)NC1=O.
What is the InChIKey of 1-hept-6-enyl-1,3-diazinane-2,4-dione?
The InChIKey is CFECPPGQRASFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-2-3-4-5-6-8-13-9-7-10(14)12-11(13)15/h2H,1,3-9H2,(H,12,14,15).
What are the key properties of 1-hept-6-enyl-1,3-diazinane-2,4-dione?
1-hept-6-enyl-1,3-diazinane-2,4-dione has a molecular weight of 210.28 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-6-enyl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 142360742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).