C21H29FN4O3 — CID 142361163
1-[(E)-5-[2-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propan-2-yl]hydrazinyl]pent-2-enyl]imidazolidine-2,4-dione (PubChem CID 142361163) has the molecular formula C21H29FN4O3 and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[(E)-5-[2-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propan-2-yl]hydrazinyl]pent-2-enyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-5-[2-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propan-2-yl]hydrazinyl]pent-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142361163 |
| Molecular Formula | C21H29FN4O3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-[(E)-5-[2-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propan-2-yl]hydrazinyl]pent-2-enyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(NNCC/C=C/CN1CC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H29FN4O3/c1-21(2,16-8-9-17(22)18(12-16)29-14-15-6-7-15)25-23-10-4-3-5-11-26-13-19(27)24-20(26)28/h3,5,8-9,12,15,23,25H,4,6-7,10-11,13-14H2,1-2H3,(H,24,27,28)/b5-3+ |
| InChIKey | SMIFZUFZNCUQCJ-HWKANZROSA-N |
| XLogP | 2.44 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|