About diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate
diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate (PubChem CID 142361312) has the molecular formula C31H52N2O4
and a molecular weight of 516.77 g/mol. Its IUPAC name is diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate.
Molecular Properties
| Compound Name | diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate |
| PubChem CID | 142361312 |
| Molecular Formula | C31H52N2O4 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.39 |
| IUPAC Name | diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate |
| SMILES | CC.CC.CC.CCOC(=O)CNCCCC(=O)N1CCCC1.OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12O.C12H22N2O3.3C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-17-12(16)10-13-7-5-6-11(15)14-8-3-4-9-14;3*1-2/h1-10,13-14H;13H,2-10H2,1H3;3*1-2H3 |
| InChIKey | CMALQNUCFCFGGB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate?
The IUPAC name of diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate (CID 142361312) is diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate.
What is the SMILES notation for diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate?
The canonical SMILES for diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate is CC.CC.CC.CCOC(=O)CNCCCC(=O)N1CCCC1.OC(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate?
The InChIKey is CMALQNUCFCFGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C12H22N2O3.3C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-17-12(16)10-13-7-5-6-11(15)14-8-3-4-9-14;3*1-2/h1-10,13-14H;13H,2-10H2,1H3;3*1-2H3.
What are the key properties of diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate?
diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate has a molecular weight of 516.77 g/mol, XLogP of 6.39, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanol;ethane;ethyl 2-[(4-oxo-4-pyrrolidin-1-ylbutyl)amino]acetate is sourced from PubChem (CID 142361312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).