About 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane
2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane (PubChem CID 142361688) has the molecular formula C11H28NOP
and a molecular weight of 221.32 g/mol. Its IUPAC name is 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane |
| PubChem CID | 142361688 |
| Molecular Formula | C11H28NOP |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane |
| SMILES | CC.CC.CCCN1CC(C)OP1C |
| InChI | InChI=1S/C7H16NOP.2C2H6/c1-4-5-8-6-7(2)9-10(8)3;2*1-2/h7H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | SVQTVUXEXSORDP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane?
The IUPAC name of 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane (CID 142361688) is 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane.
What is the SMILES notation for 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane?
The canonical SMILES for 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane is CC.CC.CCCN1CC(C)OP1C.
What is the InChIKey of 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane?
The InChIKey is SVQTVUXEXSORDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16NOP.2C2H6/c1-4-5-8-6-7(2)9-10(8)3;2*1-2/h7H,4-6H2,1-3H3;2*1-2H3.
What are the key properties of 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane?
2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane has a molecular weight of 221.32 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3-propyl-1,3,2-oxazaphospholidine;ethane is sourced from PubChem (CID 142361688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).