C27H33N5O — CID 142362033
(E)-1-[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methylidene-1-pyridinyl]-3-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)but-2-en-1-one (PubChem CID 142362033) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is (E)-1-[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methylidene-1-pyridinyl]-3-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)but-2-en-1-one.
| Compound Name | (E)-1-[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methylidene-1-pyridinyl]-3-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 142362033 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | (E)-1-[5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methylidene-1-pyridinyl]-3-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)but-2-en-1-one |
| SMILES | C=C1C=CC(N2CCN3CCC[C@H]3C2)=CN1C(=O)/C=C(\C)c1cc(CC)c2nc(C)cn2c1 |
| InChI | InChI=1S/C27H33N5O/c1-5-22-14-23(16-31-15-20(3)28-27(22)31)19(2)13-26(33)32-18-25(9-8-21(32)4)30-12-11-29-10-6-7-24(29)17-30/h8-9,13-16,18,24H,4-7,10-12,17H2,1-3H3/b19-13+/t24-/m0/s1 |
| InChIKey | MZKBVNJWPWJLDB-KGEPOTPBSA-N |
| XLogP | 4.14 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|