C29H17F11N6O2 — CID 142362613
5-[2-methyl-4-(trifluoromethoxy)phenyl]pyrazolo[1,5-b]pyridazine;3-(1,1,2,2,2-pentafluoroethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazolo[1,5-c]pyrimidine (PubChem CID 142362613) has the molecular formula C29H17F11N6O2 and a molecular weight of 690.47 g/mol. Its IUPAC name is 5-[2-methyl-4-(trifluoromethoxy)phenyl]pyrazolo[1,5-b]pyridazine;3-(1,1,2,2,2-pentafluoroethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazolo[1,5-c]pyrimidine.
| Compound Name | 5-[2-methyl-4-(trifluoromethoxy)phenyl]pyrazolo[1,5-b]pyridazine;3-(1,1,2,2,2-pentafluoroethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 142362613 |
| Molecular Formula | C29H17F11N6O2 |
| Molecular Weight | 690.47 g/mol |
| Exact Mass | 690.12 |
| IUPAC Name | 5-[2-methyl-4-(trifluoromethoxy)phenyl]pyrazolo[1,5-b]pyridazine;3-(1,1,2,2,2-pentafluoroethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazolo[1,5-c]pyrimidine |
| SMILES | Cc1cc(OC(F)(F)F)ccc1-c1cnn2nccc2c1.FC(F)(F)Oc1ccc(-c2cc3c(C(F)(F)C(F)(F)F)cnn3cn2)cc1 |
| InChI | InChI=1S/C15H7F8N3O.C14H10F3N3O/c16-13(17,14(18,19)20)10-6-25-26-7-24-11(5-12(10)26)8-1-3-9(4-2-8)27-15(21,22)23;1-9-6-12(21-14(15,16)17)2-3-13(9)10-7-11-4-5-18-20(11)19-8-10/h1-7H;2-8H,1H3 |
| InChIKey | RCIAFZVOUFPRKO-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.47 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|