About 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene
4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene (PubChem CID 142363123) has the molecular formula C19H33NS
and a molecular weight of 307.55 g/mol. Its IUPAC name is 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene |
| PubChem CID | 142363123 |
| Molecular Formula | C19H33NS |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene |
| SMILES | C=CC(C)(C)SC.C=CCC1=CC(C)(C)C=CC=N1.CC |
| InChI | InChI=1S/C11H15N.C6H12S.C2H6/c1-4-6-10-9-11(2,3)7-5-8-12-10;1-5-6(2,3)7-4;1-2/h4-5,7-9H,1,6H2,2-3H3;5H,1H2,2-4H3;1-2H3 |
| InChIKey | ZSXQQIQNQGJJRD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene?
The IUPAC name of 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene (CID 142363123) is 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene.
What is the SMILES notation for 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene?
The canonical SMILES for 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene is C=CC(C)(C)SC.C=CCC1=CC(C)(C)C=CC=N1.CC.
What is the InChIKey of 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene?
The InChIKey is ZSXQQIQNQGJJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C6H12S.C2H6/c1-4-6-10-9-11(2,3)7-5-8-12-10;1-5-6(2,3)7-4;1-2/h4-5,7-9H,1,6H2,2-3H3;5H,1H2,2-4H3;1-2H3.
What are the key properties of 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene?
4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene has a molecular weight of 307.55 g/mol, XLogP of 6.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-prop-2-enylazepine;ethane;3-methyl-3-methylsulfanylbut-1-ene is sourced from PubChem (CID 142363123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).